Products 1017360-44-9
CAS 1017360-44-9 appears in our catalog under these names: 7-Chloro-2-hydrazinyl-3-methylquinoline, 95%, 7-Chloro-2-hydrazinyl-3-methylquinoline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
(7-chloro-3-methylquinolin-2-yl)hydrazine (CAS 1017360-44-9) is a chemical compound with the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. IUPAC name: (7-chloro-3-methylquinolin-2-yl)hydrazine. InChIKey: DXOMKWXSCZHPRO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | (7-chloro-3-methylquinolin-2-yl)hydrazine |
| InChIKey | DXOMKWXSCZHPRO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(C=C2)Cl)N=C1NN |
Computed by PubChem (NCBI)