CAS 1150164-90-1 is the registry number for 3-Chloro-2-(3,5-dimethylpyrazol-1-yl)pyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-chloro-2-(3,5-dimethylpyrazol-1-yl)pyridine (CAS 1150164-90-1) is a chemical compound with the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. IUPAC name: 3-chloro-2-(3,5-dimethylpyrazol-1-yl)pyridine. InChIKey: FGOQNKQVWGUEGZ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | 3-chloro-2-(3,5-dimethylpyrazol-1-yl)pyridine |
| InChIKey | FGOQNKQVWGUEGZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=CC=N2)Cl)C |
Computed by PubChem (NCBI)