Products 1017665-61-0
CAS 1017665-61-0 appears in our catalog under these names: 3-Amoino-5-(2-chlorophenyl)-2-methylpyrazole, 98%, 3-Amoino-5-(2-chlorophenyl)-2-methylpyrazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
3-(2-chlorophenyl)-1-methylpyrazol-5-amine (CAS 1017665-61-0) is a chemical compound with the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. IUPAC name: 3-(2-chlorophenyl)-1-methylpyrazol-5-amine. InChIKey: ADEMSTSXGYEZNP-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-1-methylpyrazol-5-amine |
| InChIKey | ADEMSTSXGYEZNP-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=CC=C2Cl)N |
Computed by PubChem (NCBI)