CAS 1017479-85-4 appears in our catalog under these names: (1-(2,4-Dichlorophenyl)cyclopentyl)methanamine, 95%, (1-(2,4-Dichlorophenyl)cyclopentyl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
[1-(2,4-dichlorophenyl)cyclopentyl]methanamine (CAS 1017479-85-4) is a chemical compound with the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. IUPAC name: [1-(2,4-dichlorophenyl)cyclopentyl]methanamine. InChIKey: SCKARNZUKPSNSL-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | [1-(2,4-dichlorophenyl)cyclopentyl]methanamine |
| InChIKey | SCKARNZUKPSNSL-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CN)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)