Products 1017553-75-1

CAS 1017553-75-1 is the registry number for 2-(Furan-2-yl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(furan-2-yl)cyclopropane-1-carboxylic acid (CAS 1017553-75-1) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. IUPAC name: 2-(furan-2-yl)cyclopropane-1-carboxylic acid. InChIKey: XYZJHPPIFVPLFP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O3
Molecular weight152.15 g/mol
IUPAC name2-(furan-2-yl)cyclopropane-1-carboxylic acid
InChIKeyXYZJHPPIFVPLFP-UHFFFAOYSA-N
SMILESC1C(C1C(=O)O)C2=CC=CO2

Computed by PubChem (NCBI)