Products 1426228-54-7

CAS 1426228-54-7 is the registry number for rac-(1R,2R)-2-(Furan-2-yl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-(furan-2-yl)cyclopropane-1-carboxylic acid (CAS 1426228-54-7) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. IUPAC name: trans-(1R,2R)-2-(furan-2-yl)cyclopropane-1-carboxylic acid. InChIKey: XYZJHPPIFVPLFP-PHDIDXHHSA-N.

Identity
Molecular formulaC8H8O3
Molecular weight152.15 g/mol
IUPAC nametrans-(1R,2R)-2-(furan-2-yl)cyclopropane-1-carboxylic acid
InChIKeyXYZJHPPIFVPLFP-PHDIDXHHSA-N
SMILESC1[C@H]([C@@H]1C(=O)O)C2=CC=CO2

Computed by PubChem (NCBI)