CAS 101767-83-3 is the registry number for 1–Benzyl–3–(phenylsulfonyl)pyrrolidine. Offered by: GLPBio. Available pack sizes: 1g.
3-(benzenesulfonyl)-1-benzylpyrrolidine (CAS 101767-83-3) is a chemical compound with the molecular formula C17H19NO2S and a molecular weight of 301.4 g/mol. IUPAC name: 3-(benzenesulfonyl)-1-benzylpyrrolidine. InChIKey: OTTOUOKAVIJSMY-UHFFFAOYSA-N.
| Molecular formula | C17H19NO2S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 3-(benzenesulfonyl)-1-benzylpyrrolidine |
| InChIKey | OTTOUOKAVIJSMY-UHFFFAOYSA-N |
| SMILES | C1CN(CC1S(=O)(=O)C2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)