CAS 1206969-32-5 is the registry number for 1-Benzhydryl-3-(methylsulfonyl)azetidine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 50mg.
1-benzhydryl-3-methylsulfonylazetidine (CAS 1206969-32-5) is a chemical compound with the molecular formula C17H19NO2S and a molecular weight of 301.4 g/mol. IUPAC name: 1-benzhydryl-3-methylsulfonylazetidine. InChIKey: BMIKJGOJWRBXBX-UHFFFAOYSA-N.
| Molecular formula | C17H19NO2S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 1-benzhydryl-3-methylsulfonylazetidine |
| InChIKey | BMIKJGOJWRBXBX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)