CAS 144223-19-8 is the registry number for 5-Methyl-2-tosyl-1,2,3,4-tetrahydroisoquinoline, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-methyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline (CAS 144223-19-8) is a chemical compound with the molecular formula C17H19NO2S and a molecular weight of 301.4 g/mol. IUPAC name: 5-methyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline. InChIKey: CTDKWKCFYRHWJQ-UHFFFAOYSA-N.
| Molecular formula | C17H19NO2S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 5-methyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline |
| InChIKey | CTDKWKCFYRHWJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC3=C(C=CC=C3C2)C |
Computed by PubChem (NCBI)