Products 1017778-76-5
CAS 1017778-76-5 appears in our catalog under these names: 3-Chloro-4-ethoxy-5-fluorobenzoyl chloride, 95%, 3-Chloro-4-Ethoxy-5-fluorobenzoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-chloro-4-ethoxy-5-fluorobenzoyl chloride (CAS 1017778-76-5) is a chemical compound with the molecular formula C9H7Cl2FO2 and a molecular weight of 237.05 g/mol. IUPAC name: 3-chloro-4-ethoxy-5-fluorobenzoyl chloride. InChIKey: DVFYPWIHSIEUNN-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2FO2 |
|---|---|
| Molecular weight | 237.05 g/mol |
| IUPAC name | 3-chloro-4-ethoxy-5-fluorobenzoyl chloride |
| InChIKey | DVFYPWIHSIEUNN-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)