Products 482373-01-3
CAS 482373-01-3 is the registry number for 2-(2-Chloro-4-fluorophenoxy)propanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(2-chloro-4-fluorophenoxy)propanoyl chloride (CAS 482373-01-3) is a chemical compound with the molecular formula C9H7Cl2FO2 and a molecular weight of 237.05 g/mol. IUPAC name: 2-(2-chloro-4-fluorophenoxy)propanoyl chloride. InChIKey: ATCGXBUVEUKHDO-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2FO2 |
|---|---|
| Molecular weight | 237.05 g/mol |
| IUPAC name | 2-(2-chloro-4-fluorophenoxy)propanoyl chloride |
| InChIKey | ATCGXBUVEUKHDO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)Cl)OC1=C(C=C(C=C1)F)Cl |
Computed by PubChem (NCBI)