Products 1214332-56-5
CAS 1214332-56-5 appears in our catalog under these names: Ethyl 2,3-dichloro-6-fluorobenzoate, 95%, Ethyl 2,3-dichloro-6-fluorobenzoate, 98%, Ethyl 2,3-dichloro-6-fluorobenzoate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
Ethyl 2,3-dichloro-6-fluorobenzoate (CAS 1214332-56-5) is a chemical compound with the molecular formula C9H7Cl2FO2 and a molecular weight of 237.05 g/mol. IUPAC name: ethyl 2,3-dichloro-6-fluorobenzoate. InChIKey: OKRAJGARGMTVSR-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2FO2 |
|---|---|
| Molecular weight | 237.05 g/mol |
| IUPAC name | ethyl 2,3-dichloro-6-fluorobenzoate |
| InChIKey | OKRAJGARGMTVSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1Cl)Cl)F |
Computed by PubChem (NCBI)