Products 1214329-21-1
CAS 1214329-21-1 appears in our catalog under these names: Ethyl 3,6-dichloro-2-fluorobenzoate, 95%, Ethyl 3,6-dichloro-2-fluorobenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
Ethyl 3,6-dichloro-2-fluorobenzoate (CAS 1214329-21-1) is a chemical compound with the molecular formula C9H7Cl2FO2 and a molecular weight of 237.05 g/mol. IUPAC name: ethyl 3,6-dichloro-2-fluorobenzoate. InChIKey: MLPWVDGIBMYFBC-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2FO2 |
|---|---|
| Molecular weight | 237.05 g/mol |
| IUPAC name | ethyl 3,6-dichloro-2-fluorobenzoate |
| InChIKey | MLPWVDGIBMYFBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)Cl)Cl |
Computed by PubChem (NCBI)