CAS 1017781-27-9 appears in our catalog under these names: 5-(3-Bromophenyl)-2-methylpyrazol-3-amine, 97%, 3-(3-Bromophenyl)-1-methyl-1H-pyrazol-5-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(3-bromophenyl)-1-methylpyrazol-5-amine (CAS 1017781-27-9) is a chemical compound with the molecular formula C10H10BrN3 and a molecular weight of 252.11 g/mol. IUPAC name: 3-(3-bromophenyl)-1-methylpyrazol-5-amine. InChIKey: WYMMPPWLBLRUNA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 3-(3-bromophenyl)-1-methylpyrazol-5-amine |
| InChIKey | WYMMPPWLBLRUNA-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC(=CC=C2)Br)N |
Computed by PubChem (NCBI)