CAS 1018126-46-9 is the registry number for 3-{2,3,4-Trimethyl-6-oxo-2H,6H,7H-pyrazolo(3,4-b)pyridin-7-yl}propanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(2,3,4-trimethyl-6-oxopyrazolo[3,4-b]pyridin-7-yl)propanoic acid (CAS 1018126-46-9) is a chemical compound with the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. IUPAC name: 3-(2,3,4-trimethyl-6-oxopyrazolo[3,4-b]pyridin-7-yl)propanoic acid. InChIKey: IIKYZPZUXJANOF-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O3 |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 3-(2,3,4-trimethyl-6-oxopyrazolo[3,4-b]pyridin-7-yl)propanoic acid |
| InChIKey | IIKYZPZUXJANOF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C2=NN(C(=C12)C)C)CCC(=O)O |
Computed by PubChem (NCBI)