CAS 1018142-54-5 is the registry number for 1-(2,2-Difluoroethyl)-3,6-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2,2-difluoroethyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid (CAS 1018142-54-5) is a chemical compound with the molecular formula C11H11F2N3O2 and a molecular weight of 255.22 g/mol. IUPAC name: 1-(2,2-difluoroethyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid. InChIKey: NYZQFFKXCVGLMR-UHFFFAOYSA-N.
| Molecular formula | C11H11F2N3O2 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 1-(2,2-difluoroethyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid |
| InChIKey | NYZQFFKXCVGLMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=NN(C2=N1)CC(F)F)C)C(=O)O |
Computed by PubChem (NCBI)