CAS 937607-08-4 is the registry number for 2-(4-(Difluoromethyl)-3,6-dimethyl-1H-pyrazolo(3,4-b)pyridin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-(difluoromethyl)-3,6-dimethylpyrazolo[3,4-b]pyridin-1-yl]acetic acid (CAS 937607-08-4) is a chemical compound with the molecular formula C11H11F2N3O2 and a molecular weight of 255.22 g/mol. IUPAC name: 2-[4-(difluoromethyl)-3,6-dimethylpyrazolo[3,4-b]pyridin-1-yl]acetic acid. InChIKey: QFHHXGIQFCFBNA-UHFFFAOYSA-N.
| Molecular formula | C11H11F2N3O2 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 2-[4-(difluoromethyl)-3,6-dimethylpyrazolo[3,4-b]pyridin-1-yl]acetic acid |
| InChIKey | QFHHXGIQFCFBNA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=NN(C2=N1)CC(=O)O)C)C(F)F |
Computed by PubChem (NCBI)