CAS 118689-07-9 appears in our catalog under these names: Fluconazole EP Impurity F, 2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)-1,2-propanediol, >95% (HPLC), (2RS)-2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)propane-1,2-diol, 2–(2,4–Difluorophenyl)–3–(1H–1,2,4–triazol–1–yl)–1,2–propanediol, FLUCONAZOLE DIOL. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 100mg, 1g, 25mg, 5g.
2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol (CAS 118689-07-9) is a chemical compound with the molecular formula C11H11F2N3O2 and a molecular weight of 255.22 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol. InChIKey: BZYVJTMKMDGJRN-UHFFFAOYSA-N.
| Molecular formula | C11H11F2N3O2 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol |
| InChIKey | BZYVJTMKMDGJRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(CN2C=NC=N2)(CO)O |
Computed by PubChem (NCBI)