Products 1018240-42-0
CAS 1018240-42-0 appears in our catalog under these names: N-(2-Methylpropyl)-2,3-dihydro-1H-indene-5-sulfonamide, 95%, N-(2-Methylpropyl)-2,3-dihydro-1H-indene-5-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-(2-methylpropyl)-2,3-dihydro-1H-indene-5-sulfonamide (CAS 1018240-42-0) is a chemical compound with the molecular formula C13H19NO2S and a molecular weight of 253.36 g/mol. IUPAC name: N-(2-methylpropyl)-2,3-dihydro-1H-indene-5-sulfonamide. InChIKey: QFDOMJZOAYOZTK-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2S |
|---|---|
| Molecular weight | 253.36 g/mol |
| IUPAC name | N-(2-methylpropyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| InChIKey | QFDOMJZOAYOZTK-UHFFFAOYSA-N |
| SMILES | CC(C)CNS(=O)(=O)C1=CC2=C(CCC2)C=C1 |
Computed by PubChem (NCBI)