Products 1018246-47-3

CAS 1018246-47-3 is the registry number for 5-((5-Formyl-2-methoxyphenoxy)methyl)furan-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-[(5-formyl-2-methoxyphenoxy)methyl]furan-2-carboxylic acid (CAS 1018246-47-3) is a chemical compound with the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. IUPAC name: 5-[(5-formyl-2-methoxyphenoxy)methyl]furan-2-carboxylic acid. InChIKey: JATGRPKCQALELF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O6
Molecular weight276.24 g/mol
IUPAC name5-[(5-formyl-2-methoxyphenoxy)methyl]furan-2-carboxylic acid
InChIKeyJATGRPKCQALELF-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C=O)OCC2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)