CAS 13209-77-3 is the registry number for Ethyl 7–acetoxy–2–oxo–2H–chromene–3–carboxylate. Offered by: GLPBio. Available pack sizes: 1g.
Ethyl 7-acetyloxy-2-oxochromene-3-carboxylate (CAS 13209-77-3) is a chemical compound with the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. IUPAC name: ethyl 7-acetyloxy-2-oxochromene-3-carboxylate. InChIKey: SKVJGNVETVRDTL-UHFFFAOYSA-N.
| Molecular formula | C14H12O6 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | ethyl 7-acetyloxy-2-oxochromene-3-carboxylate |
| InChIKey | SKVJGNVETVRDTL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C(C=C2)OC(=O)C)OC1=O |
Computed by PubChem (NCBI)