CAS 637776-83-1 appears in our catalog under these names: 4,3',5'-Trihydroxy resveratrol, 95%, 4,3',5'–Trihydroxyresveratrol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg.
5-[(E)-2-(3,4,5-trihydroxyphenyl)ethenyl]benzene-1,2,3-triol (CAS 637776-83-1) is a chemical compound with the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. IUPAC name: 5-[(E)-2-(3,4,5-trihydroxyphenyl)ethenyl]benzene-1,2,3-triol. InChIKey: ZUIXFZJBOJTTET-OWOJBTEDSA-N.
| Molecular formula | C14H12O6 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | 5-[(E)-2-(3,4,5-trihydroxyphenyl)ethenyl]benzene-1,2,3-triol |
| InChIKey | ZUIXFZJBOJTTET-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)O)/C=C/C2=CC(=C(C(=C2)O)O)O |
Computed by PubChem (NCBI)