Products 1018269-73-2
CAS 1018269-73-2 is the registry number for 5-Amino-N-(1,3-dioxaindan-5-ylmethyl)-2-chlorobenzamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-amino-N-(1,3-benzodioxol-5-ylmethyl)-2-chlorobenzamide (CAS 1018269-73-2) is a chemical compound with the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. IUPAC name: 5-amino-N-(1,3-benzodioxol-5-ylmethyl)-2-chlorobenzamide. InChIKey: JZPFYDTXQWZCIB-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O3 |
|---|---|
| Molecular weight | 304.73 g/mol |
| IUPAC name | 5-amino-N-(1,3-benzodioxol-5-ylmethyl)-2-chlorobenzamide |
| InChIKey | JZPFYDTXQWZCIB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC(=O)C3=C(C=CC(=C3)N)Cl |
Computed by PubChem (NCBI)