CAS 1018473-22-7 appears in our catalog under these names: 1-(6-Chloropyrimidin-4-yl)-3-methyl-1h-pyrazol-5-amine, 95%, 1-(6-Chloropyrimidin-4-yl)-3-methyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
2-(6-chloropyrimidin-4-yl)-5-methylpyrazol-3-amine (CAS 1018473-22-7) is a chemical compound with the molecular formula C8H8ClN5 and a molecular weight of 209.63 g/mol. IUPAC name: 2-(6-chloropyrimidin-4-yl)-5-methylpyrazol-3-amine. InChIKey: IMTBRUGOHDBTTL-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN5 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 2-(6-chloropyrimidin-4-yl)-5-methylpyrazol-3-amine |
| InChIKey | IMTBRUGOHDBTTL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)