CAS 16691-46-6 appears in our catalog under these names: 5-Amino-3-[(4-chlorophenyl)amino]-1h-1,2,4-triazole, 95%, N3-(4-Chlorophenyl)-1H-1,2,4-triazole-3,5-diamine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-N-(4-chlorophenyl)-1H-1,2,4-triazole-3,5-diamine (CAS 16691-46-6) is a chemical compound with the molecular formula C8H8ClN5 and a molecular weight of 209.63 g/mol. IUPAC name: 3-N-(4-chlorophenyl)-1H-1,2,4-triazole-3,5-diamine. InChIKey: UPTMGVAONDEFRT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN5 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 3-N-(4-chlorophenyl)-1H-1,2,4-triazole-3,5-diamine |
| InChIKey | UPTMGVAONDEFRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NNC(=N2)N)Cl |
Computed by PubChem (NCBI)