CAS 37627-92-2 is the registry number for N3-(3-Chlorophenyl)-1h-1,2,4-triazole-3,5-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-N-(3-chlorophenyl)-1H-1,2,4-triazole-3,5-diamine (CAS 37627-92-2) is a chemical compound with the molecular formula C8H8ClN5 and a molecular weight of 209.63 g/mol. IUPAC name: 3-N-(3-chlorophenyl)-1H-1,2,4-triazole-3,5-diamine. InChIKey: RPFUCBPCSIJVSM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN5 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 3-N-(3-chlorophenyl)-1H-1,2,4-triazole-3,5-diamine |
| InChIKey | RPFUCBPCSIJVSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC2=NNC(=N2)N |
Computed by PubChem (NCBI)