CAS 10185-62-3 appears in our catalog under these names: 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzenesulfonyl chloride, 95%, 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzenesulfonyl chloride, Tech. , 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzene-1-sulfonyl chloride, 98+%, 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzene-1-sulfonyl chloride, 95%, 95%. Offered by: Combi-blocks, Thermo Scientific, Fluorochem, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 500mg.
3-(5-methyl-1,2,4-oxadiazol-3-yl)benzenesulfonyl chloride (CAS 10185-62-3) is a chemical compound with the molecular formula C9H7ClN2O3S and a molecular weight of 258.68 g/mol. IUPAC name: 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzenesulfonyl chloride. InChIKey: YPMVPGZXUILSPT-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3S |
|---|---|
| Molecular weight | 258.68 g/mol |
| IUPAC name | 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzenesulfonyl chloride |
| InChIKey | YPMVPGZXUILSPT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)