CAS 743444-28-2 is the registry number for 2-(Chloromethyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.
2-(chloromethyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid (CAS 743444-28-2) is a chemical compound with the molecular formula C9H7ClN2O3S and a molecular weight of 258.68 g/mol. IUPAC name: 2-(chloromethyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: LEFPWGKCGSSLRT-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3S |
|---|---|
| Molecular weight | 258.68 g/mol |
| IUPAC name | 2-(chloromethyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | LEFPWGKCGSSLRT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)CCl)C(=O)O |
Computed by PubChem (NCBI)