CAS 388088-81-1 appears in our catalog under these names: 3–(5–Methyl–1,3,4–oxadiazol–2–yl)benzene–1–sulfonyl chloride, 3-(5-Methyl-[1,3,4]oxadiazol-2-yl)-benzenesulfonyl chloride, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 10mg, 1g, 5g.
3-(5-methyl-1,3,4-oxadiazol-2-yl)benzenesulfonyl chloride (CAS 388088-81-1) is a chemical compound with the molecular formula C9H7ClN2O3S and a molecular weight of 258.68 g/mol. IUPAC name: 3-(5-methyl-1,3,4-oxadiazol-2-yl)benzenesulfonyl chloride. InChIKey: IZKQGEKIDKCBSX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3S |
|---|---|
| Molecular weight | 258.68 g/mol |
| IUPAC name | 3-(5-methyl-1,3,4-oxadiazol-2-yl)benzenesulfonyl chloride |
| InChIKey | IZKQGEKIDKCBSX-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)