Products 1018605-08-7
CAS 1018605-08-7 is the registry number for (5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,2-oxazol-3-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazol-3-yl]methanamine (CAS 1018605-08-7) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: [5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazol-3-yl]methanamine. InChIKey: UORCYZBBWDHUJM-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | [5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazol-3-yl]methanamine |
| InChIKey | UORCYZBBWDHUJM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=CC(=NO3)CN |
Computed by PubChem (NCBI)