Products 959584-25-9

CAS 959584-25-9 is the registry number for 2-(3-(4-Methoxyphenyl)-1h-pyrazol-1-yl)acetic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[3-(4-methoxyphenyl)pyrazol-1-yl]acetic acid (CAS 959584-25-9) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 2-[3-(4-methoxyphenyl)pyrazol-1-yl]acetic acid. InChIKey: HRGBMNMEZRJNAK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O3
Molecular weight232.23 g/mol
IUPAC name2-[3-(4-methoxyphenyl)pyrazol-1-yl]acetic acid
InChIKeyHRGBMNMEZRJNAK-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=NN(C=C2)CC(=O)O

Computed by PubChem (NCBI)