CAS 192701-83-0 appears in our catalog under these names: Methyl 5-(4-methoxyphenyl)-1h-pyrazole-3-carboxylate, 95%, 5-(4-Methoxy-phenyl)-2h-pyrazole-3-carboxylic acid methyl ester, 95%, Methyl 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 0,5g.
Methyl 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylate (CAS 192701-83-0) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: methyl 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylate. InChIKey: FJNMXQMHEIWMQI-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | methyl 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | FJNMXQMHEIWMQI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NNC(=C2)C(=O)OC |
Computed by PubChem (NCBI)