CAS 1018638-08-8 appears in our catalog under these names: 3-Amino-N,N-dimethyl-4-(morpholin-4-yl)benzene-1-sulfonamide, 98%, 3-Amino-N,N-dimethyl-4-(morpholin-4-yl)benzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide (CAS 1018638-08-8) is a chemical compound with the molecular formula C12H19N3O3S and a molecular weight of 285.36 g/mol. IUPAC name: 3-amino-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide. InChIKey: PZUZCFUAZCRANU-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O3S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | 3-amino-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide |
| InChIKey | PZUZCFUAZCRANU-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)N2CCOCC2)N |
Computed by PubChem (NCBI)