CAS 870692-97-0 appears in our catalog under these names: 2-Methoxy-5-((4-methylpiperazin-1-yl)sulfonyl)aniline, 98%, 2-Methoxy-5-((4-methylpiperazin-1-yl)sulfonyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-methoxy-5-(4-methylpiperazin-1-yl)sulfonylaniline (CAS 870692-97-0) is a chemical compound with the molecular formula C12H19N3O3S and a molecular weight of 285.36 g/mol. IUPAC name: 2-methoxy-5-(4-methylpiperazin-1-yl)sulfonylaniline. InChIKey: CAUYGLGWHNNDAD-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O3S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | 2-methoxy-5-(4-methylpiperazin-1-yl)sulfonylaniline |
| InChIKey | CAUYGLGWHNNDAD-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)OC)N |
Computed by PubChem (NCBI)