Products 2155859-03-1
CAS 2155859-03-1 is the registry number for 4-(4-Hydroxyphenyl)-N,N-dimethylpiperazine-1-sulfonamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-(4-hydroxyphenyl)-N,N-dimethylpiperazine-1-sulfonamide (CAS 2155859-03-1) is a chemical compound with the molecular formula C12H19N3O3S and a molecular weight of 285.36 g/mol. IUPAC name: 4-(4-hydroxyphenyl)-N,N-dimethylpiperazine-1-sulfonamide. InChIKey: BWNMGBANIFJAHK-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O3S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | 4-(4-hydroxyphenyl)-N,N-dimethylpiperazine-1-sulfonamide |
| InChIKey | BWNMGBANIFJAHK-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1CCN(CC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)