CAS 1018648-54-8 is the registry number for 3-(3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-yl)propan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine;hydrochloride (CAS 1018648-54-8) is a chemical compound with the molecular formula C11H13Cl2N3O and a molecular weight of 274.14 g/mol. IUPAC name: 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine;hydrochloride. InChIKey: GBDORUUDVUVEOV-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3O |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine;hydrochloride |
| InChIKey | GBDORUUDVUVEOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CCCN)Cl.Cl |
Computed by PubChem (NCBI)