CAS 685115-77-9 appears in our catalog under these names: 1-(3,5-Dichloropyridin-4-yl)piperidine-4-carboxamide, 95%, 1–(3,5–Dichloropyridin–4–yl)piperidine–4–carboxamide. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 100mg, 1g.
1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide (CAS 685115-77-9) is a chemical compound with the molecular formula C11H13Cl2N3O and a molecular weight of 274.14 g/mol. IUPAC name: 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide. InChIKey: BJCHGDBASIDUOJ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3O |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide |
| InChIKey | BJCHGDBASIDUOJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)N)C2=C(C=NC=C2Cl)Cl |
Computed by PubChem (NCBI)