CAS 1374407-72-3 is the registry number for 3-(3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl)propan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine;hydrochloride (CAS 1374407-72-3) is a chemical compound with the molecular formula C11H13Cl2N3O and a molecular weight of 274.14 g/mol. IUPAC name: 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine;hydrochloride. InChIKey: JILKZXWLRMLACG-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3O |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine;hydrochloride |
| InChIKey | JILKZXWLRMLACG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCCN)Cl.Cl |
Computed by PubChem (NCBI)