CAS 1018652-50-0 appears in our catalog under these names: 6-Amino-3-methyl-2(1H)-quinolinone, 97%, 6-Amino-3-methyl-1,2-dihydroquinolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-amino-3-methyl-1H-quinolin-2-one (CAS 1018652-50-0) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 6-amino-3-methyl-1H-quinolin-2-one. InChIKey: JKJQAOVIGICVSX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 6-amino-3-methyl-1H-quinolin-2-one |
| InChIKey | JKJQAOVIGICVSX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)N)NC1=O |
Computed by PubChem (NCBI)