CAS 1018814-40-8 appears in our catalog under these names: 7-Bromo-2-phenylimidazo(1,2-a)pyridine, 95%, 7-Bromo-2-phenylimidazo(1,2-a)pyridine, 7-Bromo-2-phenylimidazo[1,2-a]pyridine, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 50mg, 0,5g, 1g.
7-bromo-2-phenylimidazo[1,2-a]pyridine (CAS 1018814-40-8) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 7-bromo-2-phenylimidazo[1,2-a]pyridine. InChIKey: PZVAJJGUHTVUKT-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 7-bromo-2-phenylimidazo[1,2-a]pyridine |
| InChIKey | PZVAJJGUHTVUKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C=CC(=CC3=N2)Br |
Computed by PubChem (NCBI)