CAS 1018978-90-9 is the registry number for (S)-6-Methoxychroman-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4S)-6-methoxy-3,4-dihydro-2H-chromen-4-amine (CAS 1018978-90-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (4S)-6-methoxy-3,4-dihydro-2H-chromen-4-amine. InChIKey: APTWFKUWDZQXHL-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (4S)-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | APTWFKUWDZQXHL-VIFPVBQESA-N |
| SMILES | COC1=CC2=C(C=C1)OCC[C@@H]2N |
Computed by PubChem (NCBI)