Products 1019011-31-4
CAS 1019011-31-4 appears in our catalog under these names: 3-(2,4-Difluorophenyl)-1-methyl-1H-pyrazol-5-amine, 95%, 3-(2,4-Difluorophenyl)-1-methyl-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(2,4-difluorophenyl)-1-methylpyrazol-5-amine (CAS 1019011-31-4) is a chemical compound with the molecular formula C10H9F2N3 and a molecular weight of 209.20 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-1-methylpyrazol-5-amine. InChIKey: KKJUZXZGURNPFX-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N3 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-1-methylpyrazol-5-amine |
| InChIKey | KKJUZXZGURNPFX-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=C(C=C(C=C2)F)F)N |
Computed by PubChem (NCBI)