CAS 1019015-91-8 appears in our catalog under these names: 7-Chloro-8-fluoro-4-hydroxyquinoline-3-carboxylic acid, 95%, 7-Chloro-8-fluoro-4-hydroxyquinoline-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 1019015-91-8) is a chemical compound with the molecular formula C10H5ClFNO3 and a molecular weight of 241.60 g/mol. IUPAC name: 7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: KJOFIBYCYSWMEM-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO3 |
|---|---|
| Molecular weight | 241.60 g/mol |
| IUPAC name | 7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | KJOFIBYCYSWMEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=CN2)C(=O)O)F)Cl |
Computed by PubChem (NCBI)