CAS 1506583-02-3 appears in our catalog under these names: 5-(2-Chloro-4-fluorophenyl)-1,2-oxazole-4-carboxylic acid, 95%, 5-(2-Chloro-4-fluorophenyl)-1,2-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(2-chloro-4-fluorophenyl)-1,2-oxazole-4-carboxylic acid (CAS 1506583-02-3) is a chemical compound with the molecular formula C10H5ClFNO3 and a molecular weight of 241.60 g/mol. IUPAC name: 5-(2-chloro-4-fluorophenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: YPPVPQQVAPTUFH-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO3 |
|---|---|
| Molecular weight | 241.60 g/mol |
| IUPAC name | 5-(2-chloro-4-fluorophenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | YPPVPQQVAPTUFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)C2=C(C=NO2)C(=O)O |
Computed by PubChem (NCBI)