Products 1245031-50-8

CAS 1245031-50-8 is the registry number for 5-(3-Chloro-4-fluorophenyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1245031-50-8) is a chemical compound with the molecular formula C10H5ClFNO3 and a molecular weight of 241.60 g/mol. IUPAC name: 5-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: XPLRIOWVXSIDCZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5ClFNO3
Molecular weight241.60 g/mol
IUPAC name5-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylic acid
InChIKeyXPLRIOWVXSIDCZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CC(=NO2)C(=O)O)Cl)F

Computed by PubChem (NCBI)