CAS 1245031-50-8 is the registry number for 5-(3-Chloro-4-fluorophenyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1245031-50-8) is a chemical compound with the molecular formula C10H5ClFNO3 and a molecular weight of 241.60 g/mol. IUPAC name: 5-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: XPLRIOWVXSIDCZ-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO3 |
|---|---|
| Molecular weight | 241.60 g/mol |
| IUPAC name | 5-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | XPLRIOWVXSIDCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=NO2)C(=O)O)Cl)F |
Computed by PubChem (NCBI)