CAS 1019016-95-5 is the registry number for 4,8-Dichloro-6-fluoroquinoline, 95%. Offered by: Fluorochem. Available pack sizes: 250mg.
4,8-dichloro-6-fluoroquinoline (CAS 1019016-95-5) is a chemical compound with the molecular formula C9H4Cl2FN and a molecular weight of 216.04 g/mol. IUPAC name: 4,8-dichloro-6-fluoroquinoline. InChIKey: JPMKUTLGWKEDLS-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2FN |
|---|---|
| Molecular weight | 216.04 g/mol |
| IUPAC name | 4,8-dichloro-6-fluoroquinoline |
| InChIKey | JPMKUTLGWKEDLS-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=CC(=CC2=C1Cl)F)Cl |
Computed by PubChem (NCBI)