CAS 1019031-93-6 is the registry number for 4-Benzyl-3-chloro-4H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-benzyl-3-chloro-1,2,4-triazole (CAS 1019031-93-6) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 4-benzyl-3-chloro-1,2,4-triazole. InChIKey: NAVQHWPEKVOZQS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 4-benzyl-3-chloro-1,2,4-triazole |
| InChIKey | NAVQHWPEKVOZQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NN=C2Cl |
Computed by PubChem (NCBI)