Products 1019032-00-8
CAS 1019032-00-8 is the registry number for 3-Chloro-5-methyl-4-phenyl-4H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-chloro-5-methyl-4-phenyl-1,2,4-triazole (CAS 1019032-00-8) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 3-chloro-5-methyl-4-phenyl-1,2,4-triazole. InChIKey: FCYYXNVAPBOINZ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 3-chloro-5-methyl-4-phenyl-1,2,4-triazole |
| InChIKey | FCYYXNVAPBOINZ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N1C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)