CAS 1019323-01-3 appears in our catalog under these names: 2-[(3,5-Difluorophenyl)amino]nicotinic acid, 95%, 2-((3,5-DIfluorophenyl)amino)nicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3,5-difluoroanilino)pyridine-3-carboxylic acid (CAS 1019323-01-3) is a chemical compound with the molecular formula C12H8F2N2O2 and a molecular weight of 250.20 g/mol. IUPAC name: 2-(3,5-difluoroanilino)pyridine-3-carboxylic acid. InChIKey: KBDLSMZIUKWZPL-UHFFFAOYSA-N.
| Molecular formula | C12H8F2N2O2 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 2-(3,5-difluoroanilino)pyridine-3-carboxylic acid |
| InChIKey | KBDLSMZIUKWZPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=CC(=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)