Products 1210418-81-7

CAS 1210418-81-7 is the registry number for 3-Amino-5-fluoro-6-(2-fluorophenyl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-amino-5-fluoro-6-(2-fluorophenyl)pyridine-2-carboxylic acid (CAS 1210418-81-7) is a chemical compound with the molecular formula C12H8F2N2O2 and a molecular weight of 250.20 g/mol. IUPAC name: 3-amino-5-fluoro-6-(2-fluorophenyl)pyridine-2-carboxylic acid. InChIKey: AOWIVQYHDGLXIP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8F2N2O2
Molecular weight250.20 g/mol
IUPAC name3-amino-5-fluoro-6-(2-fluorophenyl)pyridine-2-carboxylic acid
InChIKeyAOWIVQYHDGLXIP-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=C(C=C(C(=N2)C(=O)O)N)F)F

Computed by PubChem (NCBI)